C17H24F3N3O3S — CID 46476297
1-methylsulfonyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 46476297) has the molecular formula C17H24F3N3O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 46476297 |
| Molecular Formula | C17H24F3N3O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-methylsulfonyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | CN(CCCNC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O)CC(F)(F)F |
| InChI | InChI=1S/C17H24F3N3O3S/c1-22(12-17(18,19)20)9-4-8-21-16(24)14-6-7-15-13(11-14)5-3-10-23(15)27(2,25)26/h6-7,11H,3-5,8-10,12H2,1-2H3,(H,21,24) |
| InChIKey | GBCADHONHDRHLS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|