C19H17N3O4 — CID 4647898
1-(2,4-dimethylphenyl)-6-hydroxy-5-[(4-hydroxyphenyl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 4647898) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-6-hydroxy-5-[(4-hydroxyphenyl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(2,4-dimethylphenyl)-6-hydroxy-5-[(4-hydroxyphenyl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4647898 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-6-hydroxy-5-[(4-hydroxyphenyl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/c3ccc(O)cc3)c(=O)[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C19H17N3O4/c1-11-3-8-16(12(2)9-11)22-18(25)15(17(24)21-19(22)26)10-20-13-4-6-14(23)7-5-13/h3-10,23,25H,1-2H3,(H,21,24,26)/b20-10+ |
| InChIKey | JMDPPVLDKUDEBE-KEBDBYFISA-N |
| XLogP | 2.30 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|