C21H25N3O3S — CID 46481195
N-[[3-(dimethylcarbamoyl)phenyl]methyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide (PubChem CID 46481195) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-[[3-(dimethylcarbamoyl)phenyl]methyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[[3-(dimethylcarbamoyl)phenyl]methyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46481195 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[[3-(dimethylcarbamoyl)phenyl]methyl]-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
| SMILES | CN(C)C(=O)c1cccc(CNC(=O)C2CCCN(C(=O)c3cccs3)C2)c1 |
| InChI | InChI=1S/C21H25N3O3S/c1-23(2)20(26)16-7-3-6-15(12-16)13-22-19(25)17-8-4-10-24(14-17)21(27)18-9-5-11-28-18/h3,5-7,9,11-12,17H,4,8,10,13-14H2,1-2H3,(H,22,25) |
| InChIKey | NNLDWTPMYLBOPU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |