C19H17N2O4- — CID 4648261
3-[2-(2-ethoxyanilino)-2-oxoethyl]-1H-indole-2-carboxylate (PubChem CID 4648261) has the molecular formula C19H17N2O4- and a molecular weight of 337.36 g/mol. Its IUPAC name is 3-[2-(2-ethoxyanilino)-2-oxoethyl]-1H-indole-2-carboxylate.
| Compound Name | 3-[2-(2-ethoxyanilino)-2-oxoethyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 4648261 |
| Molecular Formula | C19H17N2O4- |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-[2-(2-ethoxyanilino)-2-oxoethyl]-1H-indole-2-carboxylate |
| SMILES | CCOc1ccccc1NC(=O)Cc1c(C(=O)[O-])[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18N2O4/c1-2-25-16-10-6-5-9-15(16)20-17(22)11-13-12-7-3-4-8-14(12)21-18(13)19(23)24/h3-10,21H,2,11H2,1H3,(H,20,22)(H,23,24)/p-1 |
| InChIKey | INYHOCBBXYFECP-UHFFFAOYSA-M |
| XLogP | 2.11 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|