C20H17ClINO3 — CID 46483206
5-chloro-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-2-iodobenzamide (PubChem CID 46483206) has the molecular formula C20H17ClINO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is 5-chloro-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-2-iodobenzamide.
| Compound Name | 5-chloro-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 46483206 |
| Molecular Formula | C20H17ClINO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 5-chloro-N-[[3-(furan-2-ylmethoxymethyl)phenyl]methyl]-2-iodobenzamide |
| SMILES | O=C(NCc1cccc(COCc2ccco2)c1)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C20H17ClINO3/c21-16-6-7-19(22)18(10-16)20(24)23-11-14-3-1-4-15(9-14)12-25-13-17-5-2-8-26-17/h1-10H,11-13H2,(H,23,24) |
| InChIKey | UYQAHIJGRJEXBM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|