About 5,5-Diphenylbarbituric acid
5,5-Diphenylbarbituric acid (PubChem CID 46484) has the molecular formula C16H12N2O3
and a molecular weight of 280.28 g/mol. Its IUPAC name is 5,5-diphenyl-1,3-diazinane-2,4,6-trione.
Molecular Properties
| Compound Name | 5,5-Diphenylbarbituric acid |
| PubChem CID | 46484 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 5,5-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | C1=CC=C(C=C1)C2(C(=O)NC(=O)NC2=O)C3=CC=CC=C3 |
| InChI | InChI=1S/C16H12N2O3/c19-13-16(11-7-3-1-4-8-11,12-9-5-2-6-10-12)14(20)18-15(21)17-13/h1-10H,(H2,17,18,19,20,21) |
| InChIKey | IKVPZYAOGOJTLK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 408 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,5-Diphenylbarbituric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-Diphenylbarbituric acid?
The IUPAC name of 5,5-Diphenylbarbituric acid (CID 46484) is 5,5-diphenyl-1,3-diazinane-2,4,6-trione.
What is the SMILES notation for 5,5-Diphenylbarbituric acid?
The canonical SMILES for 5,5-Diphenylbarbituric acid is C1=CC=C(C=C1)C2(C(=O)NC(=O)NC2=O)C3=CC=CC=C3.
What is the InChIKey of 5,5-Diphenylbarbituric acid?
The InChIKey is IKVPZYAOGOJTLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O3/c19-13-16(11-7-3-1-4-8-11,12-9-5-2-6-10-12)14(20)18-15(21)17-13/h1-10H,(H2,17,18,19,20,21).
What are the key properties of 5,5-Diphenylbarbituric acid?
5,5-Diphenylbarbituric acid has a molecular weight of 280.28 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-Diphenylbarbituric acid is sourced from PubChem (CID 46484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).