About 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one
3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one (PubChem CID 46484281) has the molecular formula C19H14ClN3O2
and a molecular weight of 351.79 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one |
| PubChem CID | 46484281 |
| Molecular Formula | C19H14ClN3O2 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one |
| SMILES | Cc1ccc2ncn(Cc3coc(-c4cccc(Cl)c4)n3)c(=O)c2c1 |
| InChI | InChI=1S/C19H14ClN3O2/c1-12-5-6-17-16(7-12)19(24)23(11-21-17)9-15-10-25-18(22-15)13-3-2-4-14(20)8-13/h2-8,10-11H,9H2,1H3 |
| InChIKey | WCTALYNSCQJJBO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one?
The IUPAC name of 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one (CID 46484281) is 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one.
What is the SMILES notation for 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one?
The canonical SMILES for 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one is Cc1ccc2ncn(Cc3coc(-c4cccc(Cl)c4)n3)c(=O)c2c1.
What is the InChIKey of 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one?
The InChIKey is WCTALYNSCQJJBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClN3O2/c1-12-5-6-17-16(7-12)19(24)23(11-21-17)9-15-10-25-18(22-15)13-3-2-4-14(20)8-13/h2-8,10-11H,9H2,1H3.
What are the key properties of 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one?
3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one has a molecular weight of 351.79 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-6-methylquinazolin-4-one is sourced from PubChem (CID 46484281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).