C23H19F3N6O3 — CID 46484774
3-[(4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methyl]-5-methyl-5-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 46484774) has the molecular formula C23H19F3N6O3 and a molecular weight of 484.44 g/mol. Its IUPAC name is 3-[(4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methyl]-5-methyl-5-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methyl]-5-methyl-5-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46484774 |
| Molecular Formula | C23H19F3N6O3 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3-[(4,7-dimethyl-5-oxo-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)methyl]-5-methyl-5-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc2c(c1)c(=O)n(C)c1nnc(CN3C(=O)NC(C)(c4cccc(C(F)(F)F)c4)C3=O)n21 |
| InChI | InChI=1S/C23H19F3N6O3/c1-12-7-8-16-15(9-12)18(33)30(3)20-29-28-17(32(16)20)11-31-19(34)22(2,27-21(31)35)13-5-4-6-14(10-13)23(24,25)26/h4-10H,11H2,1-3H3,(H,27,35) |
| InChIKey | RHOSPVSCFHWNDW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|