C27H26N2O5 — CID 46485556
N-[1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 46485556) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is N-[1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 46485556 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[1-(4,5-dimethoxy-2-methylphenyl)ethyl]-2-(2-methylphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COc1cc(C)c(C(C)NC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2C)C3=O)cc1OC |
| InChI | InChI=1S/C27H26N2O5/c1-15-8-6-7-9-22(15)29-26(31)19-11-10-18(13-21(19)27(29)32)25(30)28-17(3)20-14-24(34-5)23(33-4)12-16(20)2/h6-14,17H,1-5H3,(H,28,30) |
| InChIKey | AFFXREHNUUSALN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|