C17H26ClN3O2 — CID 46486322
N-[2-[[1-(4-chlorophenyl)-2-methylpropyl]carbamoylamino]ethyl]-2-methylpropanamide (PubChem CID 46486322) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is N-[2-[[1-(4-chlorophenyl)-2-methylpropyl]carbamoylamino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[1-(4-chlorophenyl)-2-methylpropyl]carbamoylamino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 46486322 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[2-[[1-(4-chlorophenyl)-2-methylpropyl]carbamoylamino]ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)NC(c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C17H26ClN3O2/c1-11(2)15(13-5-7-14(18)8-6-13)21-17(23)20-10-9-19-16(22)12(3)4/h5-8,11-12,15H,9-10H2,1-4H3,(H,19,22)(H2,20,21,23) |
| InChIKey | OMWLJNGFNFUVBD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|