C21H20F3N3O2 — CID 46488101
4-[[4-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 46488101) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is 4-[[4-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 46488101 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-[[4-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCN(C(=O)COc3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H20F3N3O2/c22-21(23,24)18-5-7-19(8-6-18)29-15-20(28)27-11-9-26(10-12-27)14-17-3-1-16(13-25)2-4-17/h1-8H,9-12,14-15H2 |
| InChIKey | YQIILAREEPOTPT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |