C15H18N2O2 — CID 46489182
N-cyclopentyl-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 46489182) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-cyclopentyl-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-cyclopentyl-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 46489182 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-cyclopentyl-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NC1CCCC1)C1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C15H18N2O2/c18-15(16-12-8-4-5-9-12)14-10-13(17-19-14)11-6-2-1-3-7-11/h1-3,6-7,12,14H,4-5,8-10H2,(H,16,18) |
| InChIKey | BHPXTTCQGKHSTQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |