C26H28N2O3S — CID 46492077
[3-(benzenesulfonylmethyl)phenyl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 46492077) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is [3-(benzenesulfonylmethyl)phenyl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [3-(benzenesulfonylmethyl)phenyl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46492077 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [3-(benzenesulfonylmethyl)phenyl]-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1cccc(CN2CCN(C(=O)c3cccc(CS(=O)(=O)c4ccccc4)c3)CC2)c1 |
| InChI | InChI=1S/C26H28N2O3S/c1-21-7-5-8-22(17-21)19-27-13-15-28(16-14-27)26(29)24-10-6-9-23(18-24)20-32(30,31)25-11-3-2-4-12-25/h2-12,17-18H,13-16,19-20H2,1H3 |
| InChIKey | LOWDLBILFOBJFL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |