C21H23Cl2N5OS — CID 46493755
2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)acetamide (PubChem CID 46493755) has the molecular formula C21H23Cl2N5OS and a molecular weight of 464.42 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)acetamide.
| Compound Name | 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)acetamide |
|---|---|
| PubChem CID | 46493755 |
| Molecular Formula | C21H23Cl2N5OS |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-[1-(3,4-dichlorophenyl)-3,5-dimethylpyrazol-4-yl]-N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)acetamide |
| SMILES | CCN1CCc2nc(NC(=O)Cc3c(C)nn(-c4ccc(Cl)c(Cl)c4)c3C)sc2C1 |
| InChI | InChI=1S/C21H23Cl2N5OS/c1-4-27-8-7-18-19(11-27)30-21(24-18)25-20(29)10-15-12(2)26-28(13(15)3)14-5-6-16(22)17(23)9-14/h5-6,9H,4,7-8,10-11H2,1-3H3,(H,24,25,29) |
| InChIKey | VANBFGFEWQPKBL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |