C26H19ClFN3O3 — CID 46494415
N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(4-fluorobenzoyl)amino]benzamide (PubChem CID 46494415) has the molecular formula C26H19ClFN3O3 and a molecular weight of 475.91 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(4-fluorobenzoyl)amino]benzamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(4-fluorobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 46494415 |
| Molecular Formula | C26H19ClFN3O3 |
| Molecular Weight | 475.91 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[(4-fluorobenzoyl)amino]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2ccc(=O)n(Cc3ccccc3Cl)c2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H19ClFN3O3/c27-23-7-2-1-4-19(23)15-31-16-22(12-13-24(31)32)30-26(34)18-5-3-6-21(14-18)29-25(33)17-8-10-20(28)11-9-17/h1-14,16H,15H2,(H,29,33)(H,30,34) |
| InChIKey | KSYUMITYEFPLIP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |