C20H19N5O4 — CID 46494640
N-(2-amino-2-oxoethyl)-4-[[[2-(4-oxoquinazolin-3-yl)acetyl]amino]methyl]benzamide (PubChem CID 46494640) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[2-(4-oxoquinazolin-3-yl)acetyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[2-(4-oxoquinazolin-3-yl)acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 46494640 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[2-(4-oxoquinazolin-3-yl)acetyl]amino]methyl]benzamide |
| SMILES | NC(=O)CNC(=O)c1ccc(CNC(=O)Cn2cnc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C20H19N5O4/c21-17(26)10-23-19(28)14-7-5-13(6-8-14)9-22-18(27)11-25-12-24-16-4-2-1-3-15(16)20(25)29/h1-8,12H,9-11H2,(H2,21,26)(H,22,27)(H,23,28) |
| InChIKey | KKGJRGOVTFPULV-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |