C12H10I2N4O — CID 46495196
1-(3,5-diiodo-2-prop-2-enoxyphenyl)-N-(1,2,4-triazol-1-yl)methanimine (PubChem CID 46495196) has the molecular formula C12H10I2N4O and a molecular weight of 480.05 g/mol. Its IUPAC name is 1-(3,5-diiodo-2-prop-2-enoxyphenyl)-N-(1,2,4-triazol-1-yl)methanimine.
| Compound Name | 1-(3,5-diiodo-2-prop-2-enoxyphenyl)-N-(1,2,4-triazol-1-yl)methanimine |
|---|---|
| PubChem CID | 46495196 |
| Molecular Formula | C12H10I2N4O |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.89 |
| IUPAC Name | 1-(3,5-diiodo-2-prop-2-enoxyphenyl)-N-(1,2,4-triazol-1-yl)methanimine |
| SMILES | C=CCOc1c(I)cc(I)cc1C=Nn1cncn1 |
| InChI | InChI=1S/C12H10I2N4O/c1-2-3-19-12-9(4-10(13)5-11(12)14)6-16-18-8-15-7-17-18/h2,4-8H,1,3H2 |
| InChIKey | SKTODLOCHOBIBA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|