C21H21BrN4O2 — CID 46495489
3-bromo-N-[(E)-[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]benzamide (PubChem CID 46495489) has the molecular formula C21H21BrN4O2 and a molecular weight of 441.33 g/mol. Its IUPAC name is 3-bromo-N-[(E)-[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 3-bromo-N-[(E)-[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 46495489 |
| Molecular Formula | C21H21BrN4O2 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 3-bromo-N-[(E)-[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cccc(Br)c2)cc1Cn1nc(C)cc1C |
| InChI | InChI=1S/C21H21BrN4O2/c1-14-9-15(2)26(25-14)13-18-10-16(7-8-20(18)28-3)12-23-24-21(27)17-5-4-6-19(22)11-17/h4-12H,13H2,1-3H3,(H,24,27)/b23-12+ |
| InChIKey | NHQDMUTUHUESMQ-FSJBWODESA-N |
| XLogP | 4.08 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|