About N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide
N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide (PubChem CID 46496305) has the molecular formula C22H16ClN3O4
and a molecular weight of 421.84 g/mol. Its IUPAC name is N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide.
Molecular Properties
| Compound Name | N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide |
| PubChem CID | 46496305 |
| Molecular Formula | C22H16ClN3O4 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide |
| SMILES | O=C(N/N=C/c1ccc2c(c1)OCO2)c1cccc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H16ClN3O4/c23-18-7-2-1-6-17(18)22(28)25-16-5-3-4-15(11-16)21(27)26-24-12-14-8-9-19-20(10-14)30-13-29-19/h1-12H,13H2,(H,25,28)(H,26,27)/b24-12+ |
| InChIKey | XQIBBTXOAUPMRP-WYMPLXKRSA-N |
| XLogP | 4.08 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide?
The IUPAC name of N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide (CID 46496305) is N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide.
What is the SMILES notation for N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide?
The canonical SMILES for N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide is O=C(N/N=C/c1ccc2c(c1)OCO2)c1cccc(NC(=O)c2ccccc2Cl)c1.
What is the InChIKey of N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide?
The InChIKey is XQIBBTXOAUPMRP-WYMPLXKRSA-N. The full InChI is InChI=1S/C22H16ClN3O4/c23-18-7-2-1-6-17(18)22(28)25-16-5-3-4-15(11-16)21(27)26-24-12-14-8-9-19-20(10-14)30-13-29-19/h1-12H,13H2,(H,25,28)(H,26,27)/b24-12+.
What are the key properties of N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide?
N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide has a molecular weight of 421.84 g/mol, XLogP of 4.08, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[(E)-1,3-benzodioxol-5-ylmethylideneamino]carbamoyl]phenyl]-2-chlorobenzamide is sourced from PubChem (CID 46496305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).