About 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide
2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 46496316) has the molecular formula C23H20ClN3O4
and a molecular weight of 437.88 g/mol. Its IUPAC name is 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| PubChem CID | 46496316 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cccc(NC(=O)c3ccccc3Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C23H20ClN3O4/c1-30-18-11-10-16(21(13-18)31-2)14-25-27-22(28)15-6-5-7-17(12-15)26-23(29)19-8-3-4-9-20(19)24/h3-14H,1-2H3,(H,26,29)(H,27,28)/b25-14+ |
| InChIKey | PZXXJZPWECCPNV-AFUMVMLFSA-N |
| XLogP | 4.37 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide?
The IUPAC name of 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (CID 46496316) is 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
What is the SMILES notation for 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide?
The canonical SMILES for 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide is COc1ccc(/C=N/NC(=O)c2cccc(NC(=O)c3ccccc3Cl)c2)c(OC)c1.
What is the InChIKey of 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide?
The InChIKey is PZXXJZPWECCPNV-AFUMVMLFSA-N. The full InChI is InChI=1S/C23H20ClN3O4/c1-30-18-11-10-16(21(13-18)31-2)14-25-27-22(28)15-6-5-7-17(12-15)26-23(29)19-8-3-4-9-20(19)24/h3-14H,1-2H3,(H,26,29)(H,27,28)/b25-14+.
What are the key properties of 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide?
2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide has a molecular weight of 437.88 g/mol, XLogP of 4.37, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[3-[[(E)-(2,4-dimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide is sourced from PubChem (CID 46496316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).