About (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one
(4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one (PubChem CID 46496520) has the molecular formula C18H13Cl2N3O4
and a molecular weight of 406.23 g/mol. Its IUPAC name is (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one.
Molecular Properties
| Compound Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one |
| PubChem CID | 46496520 |
| Molecular Formula | C18H13Cl2N3O4 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one |
| SMILES | CCOC1=NN(c2ccc([N+](=O)[O-])cc2)C(=O)/C1=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2N3O4/c1-2-27-17-15(9-11-3-4-12(19)10-16(11)20)18(24)22(21-17)13-5-7-14(8-6-13)23(25)26/h3-10H,2H2,1H3/b15-9- |
| InChIKey | UCMBPNBYFAFBSU-DHDCSXOGSA-N |
| XLogP | 4.68 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one?
The IUPAC name of (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one (CID 46496520) is (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one.
What is the SMILES notation for (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one?
The canonical SMILES for (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one is CCOC1=NN(c2ccc([N+](=O)[O-])cc2)C(=O)/C1=C\c1ccc(Cl)cc1Cl.
What is the InChIKey of (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one?
The InChIKey is UCMBPNBYFAFBSU-DHDCSXOGSA-N. The full InChI is InChI=1S/C18H13Cl2N3O4/c1-2-27-17-15(9-11-3-4-12(19)10-16(11)20)18(24)22(21-17)13-5-7-14(8-6-13)23(25)26/h3-10H,2H2,1H3/b15-9-.
What are the key properties of (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one?
(4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one has a molecular weight of 406.23 g/mol, XLogP of 4.68, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(2,4-dichlorophenyl)methylidene]-5-ethoxy-2-(4-nitrophenyl)pyrazol-3-one is sourced from PubChem (CID 46496520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).