C18H16O6 — CID 4649699
1,3,6,8-tetramethoxyanthracene-9,10-dione (PubChem CID 4649699) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 1,3,6,8-tetramethoxyanthracene-9,10-dione.
| Compound Name | 1,3,6,8-tetramethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 4649699 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 1,3,6,8-tetramethoxyanthracene-9,10-dione |
| SMILES | COc1cc(OC)c2c(c1)C(=O)c1cc(OC)cc(OC)c1C2=O |
| InChI | InChI=1S/C18H16O6/c1-21-9-5-11-15(13(7-9)23-3)18(20)16-12(17(11)19)6-10(22-2)8-14(16)24-4/h5-8H,1-4H3 |
| InChIKey | VFFWENDDWFNSFL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|