C26H25ClN2O5 — CID 46497095
N-[(E)-3-(5-chloro-2-methylanilino)-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 46497095) has the molecular formula C26H25ClN2O5 and a molecular weight of 480.95 g/mol. Its IUPAC name is N-[(E)-3-(5-chloro-2-methylanilino)-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-(5-chloro-2-methylanilino)-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46497095 |
| Molecular Formula | C26H25ClN2O5 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[(E)-3-(5-chloro-2-methylanilino)-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cc(Cl)ccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C26H25ClN2O5/c1-16-10-11-19(27)15-20(16)28-26(31)21(29-25(30)18-8-6-5-7-9-18)12-17-13-22(32-2)24(34-4)23(14-17)33-3/h5-15H,1-4H3,(H,28,31)(H,29,30)/b21-12+ |
| InChIKey | DIXJUZVWEJLEEW-CIAFOILYSA-N |
| XLogP | 5.08 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|