About methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate
methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 46497382) has the molecular formula C15H18N2O5S
and a molecular weight of 338.39 g/mol. Its IUPAC name is methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate.
Molecular Properties
| Compound Name | methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate |
| PubChem CID | 46497382 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | COC(=O)CCCCc1scc2c1n(C(C)=O)c(=O)n2C(C)=O |
| InChI | InChI=1S/C15H18N2O5S/c1-9(18)16-11-8-23-12(6-4-5-7-13(20)22-3)14(11)17(10(2)19)15(16)21/h8H,4-7H2,1-3H3 |
| InChIKey | NJIAGJAQLXDFKE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate?
The IUPAC name of methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate (CID 46497382) is methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate.
What is the SMILES notation for methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate?
The canonical SMILES for methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate is COC(=O)CCCCc1scc2c1n(C(C)=O)c(=O)n2C(C)=O.
What is the InChIKey of methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate?
The InChIKey is NJIAGJAQLXDFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5S/c1-9(18)16-11-8-23-12(6-4-5-7-13(20)22-3)14(11)17(10(2)19)15(16)21/h8H,4-7H2,1-3H3.
What are the key properties of methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate?
methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate has a molecular weight of 338.39 g/mol, XLogP of 2.07, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1,3-diacetyl-2-oxothieno[3,4-d]imidazol-4-yl)pentanoate is sourced from PubChem (CID 46497382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).