C27H19Cl5N2O6 — CID 46497705
4,5,6,7-tetrachloro-2-[1-(3-chloro-2-methylphenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)azetidin-3-yl]isoindole-1,3-dione (PubChem CID 46497705) has the molecular formula C27H19Cl5N2O6 and a molecular weight of 644.72 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[1-(3-chloro-2-methylphenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)azetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[1-(3-chloro-2-methylphenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)azetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46497705 |
| Molecular Formula | C27H19Cl5N2O6 |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 641.97 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[1-(3-chloro-2-methylphenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)azetidin-3-yl]isoindole-1,3-dione |
| SMILES | COc1cc(C2C(N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)C(=O)N2c2cccc(Cl)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C27H19Cl5N2O6/c1-10-12(28)6-5-7-13(10)33-22(11-8-14(38-2)24(40-4)15(9-11)39-3)23(27(33)37)34-25(35)16-17(26(34)36)19(30)21(32)20(31)18(16)29/h5-9,22-23H,1-4H3 |
| InChIKey | KDPYOPGPXPCHIT-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|