C23H24ClNO5S2 — CID 46498445
(5E)-5-[[3-chloro-5-methoxy-4-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 46498445) has the molecular formula C23H24ClNO5S2 and a molecular weight of 494.03 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-5-methoxy-4-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-chloro-5-methoxy-4-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 46498445 |
| Molecular Formula | C23H24ClNO5S2 |
| Molecular Weight | 494.03 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | (5E)-5-[[3-chloro-5-methoxy-4-[2-[2-(4-methylphenoxy)ethoxy]ethoxy]phenyl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2/SC(=S)N(C)C2=O)cc(Cl)c1OCCOCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C23H24ClNO5S2/c1-15-4-6-17(7-5-15)29-10-8-28-9-11-30-21-18(24)12-16(13-19(21)27-3)14-20-22(26)25(2)23(31)32-20/h4-7,12-14H,8-11H2,1-3H3/b20-14+ |
| InChIKey | WENCNILLDZEKGC-XSFVSMFZSA-N |
| XLogP | 4.96 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.03 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|