C25H22F3N3O — CID 46498613
2-(4-butylphenyl)-N-[4-(trifluoromethoxy)phenyl]quinazolin-4-amine (PubChem CID 46498613) has the molecular formula C25H22F3N3O and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-(4-butylphenyl)-N-[4-(trifluoromethoxy)phenyl]quinazolin-4-amine.
| Compound Name | 2-(4-butylphenyl)-N-[4-(trifluoromethoxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 46498613 |
| Molecular Formula | C25H22F3N3O |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 2-(4-butylphenyl)-N-[4-(trifluoromethoxy)phenyl]quinazolin-4-amine |
| SMILES | CCCCc1ccc(-c2nc(Nc3ccc(OC(F)(F)F)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H22F3N3O/c1-2-3-6-17-9-11-18(12-10-17)23-30-22-8-5-4-7-21(22)24(31-23)29-19-13-15-20(16-14-19)32-25(26,27)28/h4-5,7-16H,2-3,6H2,1H3,(H,29,30,31) |
| InChIKey | GWIWFEZFQFZMEB-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |