C34H28N2O10 — CID 46498786
[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]oxyphenyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate (PubChem CID 46498786) has the molecular formula C34H28N2O10 and a molecular weight of 624.60 g/mol. Its IUPAC name is [4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]oxyphenyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate.
| Compound Name | [4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]oxyphenyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 46498786 |
| Molecular Formula | C34H28N2O10 |
| Molecular Weight | 624.60 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | [4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]oxyphenyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate |
| SMILES | O=C(Oc1ccc(OC(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)cc1)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C34H28N2O10/c37-29-25-11-5-19(15-27(25)31(39)35(29)17-23-3-1-13-43-23)33(41)45-21-7-9-22(10-8-21)46-34(42)20-6-12-26-28(16-20)32(40)36(30(26)38)18-24-4-2-14-44-24/h5-12,15-16,23-24H,1-4,13-14,17-18H2 |
| InChIKey | PUBYBTBXORWTGN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|