About 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane
2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane (PubChem CID 46499506) has the molecular formula C13H11Cl2NO2S3
and a molecular weight of 380.34 g/mol. Its IUPAC name is 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane.
Molecular Properties
| Compound Name | 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane |
| PubChem CID | 46499506 |
| Molecular Formula | C13H11Cl2NO2S3 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane |
| SMILES | Cc1ccc(SC(=C(Cl)Cl)C(=C2SCCS2)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H11Cl2NO2S3/c1-8-2-4-9(5-3-8)21-11(12(14)15)10(16(17)18)13-19-6-7-20-13/h2-5H,6-7H2,1H3 |
| InChIKey | OBDRADDFYYPHGK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane?
The IUPAC name of 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane (CID 46499506) is 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane.
What is the SMILES notation for 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane?
The canonical SMILES for 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane is Cc1ccc(SC(=C(Cl)Cl)C(=C2SCCS2)[N+](=O)[O-])cc1.
What is the InChIKey of 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane?
The InChIKey is OBDRADDFYYPHGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2NO2S3/c1-8-2-4-9(5-3-8)21-11(12(14)15)10(16(17)18)13-19-6-7-20-13/h2-5H,6-7H2,1H3.
What are the key properties of 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane?
2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane has a molecular weight of 380.34 g/mol, XLogP of 5.66, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-dithiolane is sourced from PubChem (CID 46499506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).