C16H11F12NO4 — CID 46499720
N-[2-[[2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide (PubChem CID 46499720) has the molecular formula C16H11F12NO4 and a molecular weight of 509.24 g/mol. Its IUPAC name is N-[2-[[2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide.
| Compound Name | N-[2-[[2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
|---|---|
| PubChem CID | 46499720 |
| Molecular Formula | C16H11F12NO4 |
| Molecular Weight | 509.24 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | N-[2-[[2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzamide |
| SMILES | O=C(NC(OCC1COC(C(F)(F)F)(C(F)(F)F)O1)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C16H11F12NO4/c17-13(18,19)11(14(20,21)22,29-10(30)8-4-2-1-3-5-8)31-6-9-7-32-12(33-9,15(23,24)25)16(26,27)28/h1-5,9H,6-7H2,(H,29,30) |
| InChIKey | FVVRGNVQIPZOMZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|