About N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide
N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide (PubChem CID 46499846) has the molecular formula C17H16F3N3O3
and a molecular weight of 367.33 g/mol. Its IUPAC name is N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide |
| PubChem CID | 46499846 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Oc2c(F)c(F)nc(N3CCOCC3)c2F)cc1 |
| InChI | InChI=1S/C17H16F3N3O3/c1-10(24)21-11-2-4-12(5-3-11)26-15-13(18)16(20)22-17(14(15)19)23-6-8-25-9-7-23/h2-5H,6-9H2,1H3,(H,21,24) |
| InChIKey | NHIAYOUCQDJLEX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide?
The IUPAC name of N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide (CID 46499846) is N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide.
What is the SMILES notation for N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide?
The canonical SMILES for N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide is CC(=O)Nc1ccc(Oc2c(F)c(F)nc(N3CCOCC3)c2F)cc1.
What is the InChIKey of N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide?
The InChIKey is NHIAYOUCQDJLEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F3N3O3/c1-10(24)21-11-2-4-12(5-3-11)26-15-13(18)16(20)22-17(14(15)19)23-6-8-25-9-7-23/h2-5H,6-9H2,1H3,(H,21,24).
What are the key properties of N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide?
N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide has a molecular weight of 367.33 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,3,5-trifluoro-6-morpholin-4-yl-4-pyridinyl)oxy]phenyl]acetamide is sourced from PubChem (CID 46499846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).