About (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline
(2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline (PubChem CID 46500798) has the molecular formula C24H25N2+
and a molecular weight of 341.48 g/mol. Its IUPAC name is (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline.
Molecular Properties
| Compound Name | (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline |
| PubChem CID | 46500798 |
| Molecular Formula | C24H25N2+ |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline |
| SMILES | CCN1/C(=C/c2ccc(C)c[n+]2C)C=Cc2cc(C)c3ccccc3c21 |
| InChI | InChI=1S/C24H25N2/c1-5-26-21(15-20-12-10-17(2)16-25(20)4)13-11-19-14-18(3)22-8-6-7-9-23(22)24(19)26/h6-16H,5H2,1-4H3/q+1 |
| InChIKey | ZGNGCHLPHWFLCB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline?
The IUPAC name of (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline (CID 46500798) is (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline.
What is the SMILES notation for (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline?
The canonical SMILES for (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline is CCN1/C(=C/c2ccc(C)c[n+]2C)C=Cc2cc(C)c3ccccc3c21.
What is the InChIKey of (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline?
The InChIKey is ZGNGCHLPHWFLCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N2/c1-5-26-21(15-20-12-10-17(2)16-25(20)4)13-11-19-14-18(3)22-8-6-7-9-23(22)24(19)26/h6-16H,5H2,1-4H3/q+1.
What are the key properties of (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline?
(2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline has a molecular weight of 341.48 g/mol, XLogP of 5.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(1,5-dimethylpyridin-1-ium-2-yl)methylidene]-1-ethyl-6-methylbenzo[h]quinoline is sourced from PubChem (CID 46500798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).