C22H22NO4+ — CID 46500809
methyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1,3,3-trimethylindol-1-ium-6-carboxylate (PubChem CID 46500809) has the molecular formula C22H22NO4+ and a molecular weight of 364.42 g/mol. Its IUPAC name is methyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1,3,3-trimethylindol-1-ium-6-carboxylate.
| Compound Name | methyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1,3,3-trimethylindol-1-ium-6-carboxylate |
|---|---|
| PubChem CID | 46500809 |
| Molecular Formula | C22H22NO4+ |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1,3,3-trimethylindol-1-ium-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[N+](C)=C(/C=C/c1ccc3c(c1)OCO3)C2(C)C |
| InChI | InChI=1S/C22H22NO4/c1-22(2)16-8-7-15(21(24)25-4)12-17(16)23(3)20(22)10-6-14-5-9-18-19(11-14)27-13-26-18/h5-12H,13H2,1-4H3/q+1/b10-6+ |
| InChIKey | QUDAQPAVBRUHAV-UXBLZVDNSA-N |
| XLogP | 3.92 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|