C24H33N3O — CID 46500834
1-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-2-(dimethylamino)ethanone (PubChem CID 46500834) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 1-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-2-(dimethylamino)ethanone.
| Compound Name | 1-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 46500834 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 1-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-2-(dimethylamino)ethanone |
| SMILES | CN(C)CC(=O)N1CCn2c3c(c4cc(C5CCCCC5)ccc42)CCCC31 |
| InChI | InChI=1S/C24H33N3O/c1-25(2)16-23(28)26-13-14-27-21-12-11-18(17-7-4-3-5-8-17)15-20(21)19-9-6-10-22(26)24(19)27/h11-12,15,17,22H,3-10,13-14,16H2,1-2H3 |
| InChIKey | GVJWWWGOKWHSQH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|