C25H24ClN3O2 — CID 46501151
(3E)-N-(3-chloro-2-methylphenyl)-3-[[2-(4-phenylphenyl)acetyl]hydrazinylidene]butanamide (PubChem CID 46501151) has the molecular formula C25H24ClN3O2 and a molecular weight of 433.94 g/mol. Its IUPAC name is (3E)-N-(3-chloro-2-methylphenyl)-3-[[2-(4-phenylphenyl)acetyl]hydrazinylidene]butanamide.
| Compound Name | (3E)-N-(3-chloro-2-methylphenyl)-3-[[2-(4-phenylphenyl)acetyl]hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 46501151 |
| Molecular Formula | C25H24ClN3O2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (3E)-N-(3-chloro-2-methylphenyl)-3-[[2-(4-phenylphenyl)acetyl]hydrazinylidene]butanamide |
| SMILES | C/C(CC(=O)Nc1cccc(Cl)c1C)=N\NC(=O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24ClN3O2/c1-17(15-24(30)27-23-10-6-9-22(26)18(23)2)28-29-25(31)16-19-11-13-21(14-12-19)20-7-4-3-5-8-20/h3-14H,15-16H2,1-2H3,(H,27,30)(H,29,31)/b28-17+ |
| InChIKey | SBLKGGKFMABIKM-OGLMXYFKSA-N |
| XLogP | 5.38 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|