C31H26BrN3O4 — CID 46501237
N-[(Z)-3-[(2Z)-2-[[2-[(3-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 46501237) has the molecular formula C31H26BrN3O4 and a molecular weight of 584.47 g/mol. Its IUPAC name is N-[(Z)-3-[(2Z)-2-[[2-[(3-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2Z)-2-[[2-[(3-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46501237 |
| Molecular Formula | C31H26BrN3O4 |
| Molecular Weight | 584.47 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | N-[(Z)-3-[(2Z)-2-[[2-[(3-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)N/N=C\c2ccccc2OCc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C31H26BrN3O4/c1-38-27-16-14-22(15-17-27)19-28(34-30(36)24-9-3-2-4-10-24)31(37)35-33-20-25-11-5-6-13-29(25)39-21-23-8-7-12-26(32)18-23/h2-20H,21H2,1H3,(H,34,36)(H,35,37)/b28-19-,33-20- |
| InChIKey | AYHVEDRVWRPORI-TUVGLCNXSA-N |
| XLogP | 5.96 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|