C22H25N5O — CID 46501384
(E)-N-[(E)-(3-methoxyphenyl)methylideneamino]-1-phenyl-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine (PubChem CID 46501384) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is (E)-N-[(E)-(3-methoxyphenyl)methylideneamino]-1-phenyl-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine.
| Compound Name | (E)-N-[(E)-(3-methoxyphenyl)methylideneamino]-1-phenyl-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
|---|---|
| PubChem CID | 46501384 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (E)-N-[(E)-(3-methoxyphenyl)methylideneamino]-1-phenyl-1-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
| SMILES | COc1cccc(/C=N/N=C(/c2ccccc2)C23CN4CN(CN(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H25N5O/c1-28-20-9-5-6-18(10-20)11-23-24-21(19-7-3-2-4-8-19)22-12-25-15-26(13-22)17-27(14-22)16-25/h2-11H,12-17H2,1H3/b23-11+,24-21- |
| InChIKey | XDTQABDXBCFVLT-VLFOJNRWSA-N |
| XLogP | 2.32 |
| TPSA | 43.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|