C17H17Br2N3O2 — CID 46502238
2-(2,4-dibromoanilino)-N-[(E)-(4-ethoxyphenyl)methylideneamino]acetamide (PubChem CID 46502238) has the molecular formula C17H17Br2N3O2 and a molecular weight of 455.15 g/mol. Its IUPAC name is 2-(2,4-dibromoanilino)-N-[(E)-(4-ethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dibromoanilino)-N-[(E)-(4-ethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 46502238 |
| Molecular Formula | C17H17Br2N3O2 |
| Molecular Weight | 455.15 g/mol |
| Exact Mass | 452.97 |
| IUPAC Name | 2-(2,4-dibromoanilino)-N-[(E)-(4-ethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)CNc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C17H17Br2N3O2/c1-2-24-14-6-3-12(4-7-14)10-21-22-17(23)11-20-16-8-5-13(18)9-15(16)19/h3-10,20H,2,11H2,1H3,(H,22,23)/b21-10+ |
| InChIKey | DYOPLYFLNBYSGL-UFFVCSGVSA-N |
| XLogP | 4.17 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|