C24H22IN3O3 — CID 46502393
N-(4-iodophenyl)-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]butanediamide (PubChem CID 46502393) has the molecular formula C24H22IN3O3 and a molecular weight of 527.36 g/mol. Its IUPAC name is N-(4-iodophenyl)-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N-(4-iodophenyl)-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 46502393 |
| Molecular Formula | C24H22IN3O3 |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | N-(4-iodophenyl)-N'-[(E)-(2-phenylmethoxyphenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccc(I)cc1)N/N=C/c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22IN3O3/c25-20-10-12-21(13-11-20)27-23(29)14-15-24(30)28-26-16-19-8-4-5-9-22(19)31-17-18-6-2-1-3-7-18/h1-13,16H,14-15,17H2,(H,27,29)(H,28,30)/b26-16+ |
| InChIKey | FGICVXQDQOTDES-WGOQTCKBSA-N |
| XLogP | 4.74 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|