C27H17Cl2N5O4 — CID 46502612
4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-1,2,4-triphenylpyrazolidine-3,5-dione (PubChem CID 46502612) has the molecular formula C27H17Cl2N5O4 and a molecular weight of 546.37 g/mol. Its IUPAC name is 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-1,2,4-triphenylpyrazolidine-3,5-dione.
| Compound Name | 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-1,2,4-triphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 46502612 |
| Molecular Formula | C27H17Cl2N5O4 |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-1,2,4-triphenylpyrazolidine-3,5-dione |
| SMILES | O=C1N(c2ccccc2)N(c2ccccc2)C(=O)C1(/N=N/c1c(Cl)cc([N+](=O)[O-])cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C27H17Cl2N5O4/c28-22-16-21(34(37)38)17-23(29)24(22)30-31-27(18-10-4-1-5-11-18)25(35)32(19-12-6-2-7-13-19)33(26(27)36)20-14-8-3-9-15-20/h1-17H/b31-30+ |
| InChIKey | OAFRZKACUCOACA-NVQSTNCTSA-N |
| XLogP | 6.88 |
| TPSA | 108.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|