C31H33BrFNO2 — CID 46503253
9-(3-bromo-4-fluorophenyl)-10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 46503253) has the molecular formula C31H33BrFNO2 and a molecular weight of 550.51 g/mol. Its IUPAC name is 9-(3-bromo-4-fluorophenyl)-10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3-bromo-4-fluorophenyl)-10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 46503253 |
| Molecular Formula | C31H33BrFNO2 |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 9-(3-bromo-4-fluorophenyl)-10-(3,4-dimethylphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | Cc1ccc(N2C3=C(C(=O)CC(C)(C)C3)C(c3ccc(F)c(Br)c3)C3=C2CC(C)(C)CC3=O)cc1C |
| InChI | InChI=1S/C31H33BrFNO2/c1-17-7-9-20(11-18(17)2)34-23-13-30(3,4)15-25(35)28(23)27(19-8-10-22(33)21(32)12-19)29-24(34)14-31(5,6)16-26(29)36/h7-12,27H,13-16H2,1-6H3 |
| InChIKey | PPMMPZZTWODEJR-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |