C8H8N4O2 — CID 46503573
1,7-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 46503573) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 1,7-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,7-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 46503573 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 1,7-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | Cc1ncc2c(=O)[nH]c(=O)n(C)c2n1 |
| InChI | InChI=1S/C8H8N4O2/c1-4-9-3-5-6(10-4)12(2)8(14)11-7(5)13/h3H,1-2H3,(H,11,13,14) |
| InChIKey | QTDKWGPEXSIHDE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |