C34H27F3N4O4 — CID 46504369
ethyl 3-[[8-oxo-12-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate (PubChem CID 46504369) has the molecular formula C34H27F3N4O4 and a molecular weight of 612.61 g/mol. Its IUPAC name is ethyl 3-[[8-oxo-12-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate.
| Compound Name | ethyl 3-[[8-oxo-12-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
|---|---|
| PubChem CID | 46504369 |
| Molecular Formula | C34H27F3N4O4 |
| Molecular Weight | 612.61 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | ethyl 3-[[8-oxo-12-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2cc(N3CCN(c4cccc(C(F)(F)F)c4)CC3)c3noc4c3c2C(=O)c2ccccc2-4)c1 |
| InChI | InChI=1S/C34H27F3N4O4/c1-2-44-33(43)20-7-5-9-22(17-20)38-26-19-27(30-29-28(26)31(42)24-11-3-4-12-25(24)32(29)45-39-30)41-15-13-40(14-16-41)23-10-6-8-21(18-23)34(35,36)37/h3-12,17-19,38H,2,13-16H2,1H3 |
| InChIKey | UUMHULFRQYTEDU-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.61 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|