About (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one
(3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 46505680) has the molecular formula C20H15Cl2F2NO
and a molecular weight of 394.25 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one.
Molecular Properties
| Compound Name | (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one |
| PubChem CID | 46505680 |
| Molecular Formula | C20H15Cl2F2NO |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | CN1C/C(=C\c2c(F)cccc2Cl)C(=O)/C(=C/c2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C20H15Cl2F2NO/c1-25-10-12(8-14-16(21)4-2-6-18(14)23)20(26)13(11-25)9-15-17(22)5-3-7-19(15)24/h2-9H,10-11H2,1H3/b12-8+,13-9+ |
| InChIKey | HFRCIIXTCHJWEU-QHKWOANTSA-N |
| XLogP | 5.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one?
The IUPAC name of (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one (CID 46505680) is (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one.
What is the SMILES notation for (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one?
The canonical SMILES for (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one is CN1C/C(=C\c2c(F)cccc2Cl)C(=O)/C(=C/c2c(F)cccc2Cl)C1.
What is the InChIKey of (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one?
The InChIKey is HFRCIIXTCHJWEU-QHKWOANTSA-N. The full InChI is InChI=1S/C20H15Cl2F2NO/c1-25-10-12(8-14-16(21)4-2-6-18(14)23)20(26)13(11-25)9-15-17(22)5-3-7-19(15)24/h2-9H,10-11H2,1H3/b12-8+,13-9+.
What are the key properties of (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one?
(3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one has a molecular weight of 394.25 g/mol, XLogP of 5.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-3,5-bis[(2-chloro-6-fluorophenyl)methylidene]-1-methylpiperidin-4-one is sourced from PubChem (CID 46505680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).