About (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one
(3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 46505742) has the molecular formula C22H21Br2NO3
and a molecular weight of 507.22 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one.
Molecular Properties
| Compound Name | (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one |
| PubChem CID | 46505742 |
| Molecular Formula | C22H21Br2NO3 |
| Molecular Weight | 507.22 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | COc1ccc(/C=C2\CN(C)C/C(=C\c3ccc(OC)c(Br)c3)C2=O)cc1Br |
| InChI | InChI=1S/C22H21Br2NO3/c1-25-12-16(8-14-4-6-20(27-2)18(23)10-14)22(26)17(13-25)9-15-5-7-21(28-3)19(24)11-15/h4-11H,12-13H2,1-3H3/b16-8+,17-9+ |
| InChIKey | SYULOIQVQBNHSI-GONBZBRSSA-N |
| XLogP | 5.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.22 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one?
The IUPAC name of (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one (CID 46505742) is (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one.
What is the SMILES notation for (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one?
The canonical SMILES for (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one is COc1ccc(/C=C2\CN(C)C/C(=C\c3ccc(OC)c(Br)c3)C2=O)cc1Br.
What is the InChIKey of (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one?
The InChIKey is SYULOIQVQBNHSI-GONBZBRSSA-N. The full InChI is InChI=1S/C22H21Br2NO3/c1-25-12-16(8-14-4-6-20(27-2)18(23)10-14)22(26)17(13-25)9-15-5-7-21(28-3)19(24)11-15/h4-11H,12-13H2,1-3H3/b16-8+,17-9+.
What are the key properties of (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one?
(3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one has a molecular weight of 507.22 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-3,5-bis[(3-bromo-4-methoxyphenyl)methylidene]-1-methylpiperidin-4-one is sourced from PubChem (CID 46505742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).