C28H28N4O6S2 — CID 46506631
2-[[11-acetyl-4-(3-methoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 46506631) has the molecular formula C28H28N4O6S2 and a molecular weight of 580.69 g/mol. Its IUPAC name is 2-[[11-acetyl-4-(3-methoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[[11-acetyl-4-(3-methoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46506631 |
| Molecular Formula | C28H28N4O6S2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | 2-[[11-acetyl-4-(3-methoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1cccc(-n2c(SCC(=O)Nc3ccc(OC)c(OC)c3)nc3sc4c(c3c2=O)CCN(C(C)=O)C4)c1 |
| InChI | InChI=1S/C28H28N4O6S2/c1-16(33)31-11-10-20-23(14-31)40-26-25(20)27(35)32(18-6-5-7-19(13-18)36-2)28(30-26)39-15-24(34)29-17-8-9-21(37-3)22(12-17)38-4/h5-9,12-13H,10-11,14-15H2,1-4H3,(H,29,34) |
| InChIKey | LFDGXOPDGOXQFX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |