C23H24ClNO7 — CID 4650856
4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-[2-(2-hydroxyethoxy)ethyl]pyrrolidine-2,3-dione (PubChem CID 4650856) has the molecular formula C23H24ClNO7 and a molecular weight of 461.90 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-[2-(2-hydroxyethoxy)ethyl]pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-[2-(2-hydroxyethoxy)ethyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4650856 |
| Molecular Formula | C23H24ClNO7 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-[2-(2-hydroxyethoxy)ethyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2C(=C(O)c3ccc(Cl)cc3)C(=O)C(=O)N2CCOCCO)cc1OC |
| InChI | InChI=1S/C23H24ClNO7/c1-30-17-8-5-15(13-18(17)31-2)20-19(21(27)14-3-6-16(24)7-4-14)22(28)23(29)25(20)9-11-32-12-10-26/h3-8,13,20,26-27H,9-12H2,1-2H3 |
| InChIKey | CWZZXNCMSFWGGH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|