About 2-(diethylamino)ethyl 4-(butylamino)benzoate
2-(diethylamino)ethyl 4-(butylamino)benzoate (PubChem CID 4651) has the molecular formula C17H28N2O2
and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-(butylamino)benzoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 4-(butylamino)benzoate |
| PubChem CID | 4651 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-(diethylamino)ethyl 4-(butylamino)benzoate |
| SMILES | CCCCNc1ccc(C(=O)OCCN(CC)CC)cc1 |
| InChI | InChI=1S/C17H28N2O2/c1-4-7-12-18-16-10-8-15(9-11-16)17(20)21-14-13-19(5-2)6-3/h8-11,18H,4-7,12-14H2,1-3H3 |
| InChIKey | JQMCLLAJJLVYOC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 4-(butylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 4-(butylamino)benzoate?
The IUPAC name of 2-(diethylamino)ethyl 4-(butylamino)benzoate (CID 4651) is 2-(diethylamino)ethyl 4-(butylamino)benzoate.
What is the SMILES notation for 2-(diethylamino)ethyl 4-(butylamino)benzoate?
The canonical SMILES for 2-(diethylamino)ethyl 4-(butylamino)benzoate is CCCCNc1ccc(C(=O)OCCN(CC)CC)cc1.
What is the InChIKey of 2-(diethylamino)ethyl 4-(butylamino)benzoate?
The InChIKey is JQMCLLAJJLVYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O2/c1-4-7-12-18-16-10-8-15(9-11-16)17(20)21-14-13-19(5-2)6-3/h8-11,18H,4-7,12-14H2,1-3H3.
What are the key properties of 2-(diethylamino)ethyl 4-(butylamino)benzoate?
2-(diethylamino)ethyl 4-(butylamino)benzoate has a molecular weight of 292.42 g/mol, XLogP of 3.40, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 4-(butylamino)benzoate is sourced from PubChem (CID 4651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).