C17H23N3S2 — CID 4651024
(4-cyano-4-phenylpiperidin-1-yl) N,N-diethylcarbamodithioate (PubChem CID 4651024) has the molecular formula C17H23N3S2 and a molecular weight of 333.53 g/mol. Its IUPAC name is (4-cyano-4-phenylpiperidin-1-yl) N,N-diethylcarbamodithioate.
| Compound Name | (4-cyano-4-phenylpiperidin-1-yl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 4651024 |
| Molecular Formula | C17H23N3S2 |
| Molecular Weight | 333.53 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (4-cyano-4-phenylpiperidin-1-yl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SN1CCC(C#N)(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H23N3S2/c1-3-19(4-2)16(21)22-20-12-10-17(14-18,11-13-20)15-8-6-5-7-9-15/h5-9H,3-4,10-13H2,1-2H3 |
| InChIKey | XWOPYPOLUARBKJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|