C25H33NO2 — CID 46511092
3-(4-tert-butylphenyl)-1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]propan-1-one (PubChem CID 46511092) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-(4-tert-butylphenyl)-1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 46511092 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)(C)c1ccc(CCC(=O)N2CCC(C(O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H33NO2/c1-25(2,3)22-12-9-19(10-13-22)11-14-23(27)26-17-15-21(16-18-26)24(28)20-7-5-4-6-8-20/h4-10,12-13,21,24,28H,11,14-18H2,1-3H3 |
| InChIKey | AWYWKNPYOOLKNY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |